C56H48N3OPt- — CID 153476737
2-[1-(2-tert-butyl-4-phenylphenyl)-4-[3-tert-butyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 153476737) has the molecular formula C56H48N3OPt- and a molecular weight of 974.10 g/mol. Its IUPAC name is 2-[1-(2-tert-butyl-4-phenylphenyl)-4-[3-tert-butyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-(2-tert-butyl-4-phenylphenyl)-4-[3-tert-butyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153476737 |
| Molecular Formula | C56H48N3OPt- |
| Molecular Weight | 974.10 g/mol |
| Exact Mass | 973.35 |
| IUPAC Name | 2-[1-(2-tert-butyl-4-phenylphenyl)-4-[3-tert-butyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc(-c4ccccc4)cc3)ccn2)[c-]c(-c2cccc3c2nc(-c2ccccc2O)n3-c2ccc(-c3ccccc3)cc2C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C56H48N3O.Pt/c1-55(2,3)45-33-43(32-44(34-45)49-36-42(30-31-57-49)40-26-24-39(25-27-40)37-16-9-7-10-17-37)46-21-15-22-51-53(46)58-54(47-20-13-14-23-52(47)60)59(51)50-29-28-41(35-48(50)56(4,5)6)38-18-11-8-12-19-38;/h7-31,33-36,60H,1-6H3;/q-1; |
| InChIKey | BYIZDXKQALJFDD-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.10 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|