C26H17IrN6 — CID 153483382
CID 153483382 (PubChem CID 153483382) has the molecular formula C26H17IrN6 and a molecular weight of 605.68 g/mol.
| Compound Name | CID 153483382 |
|---|---|
| PubChem CID | 153483382 |
| Molecular Formula | C26H17IrN6 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | — |
| SMILES | [Ir+3].[c-]1c2ccccc2n2c1c1ncccc1c1ncncc12.[c-]1ccccc1N1C=CN[CH-]1 |
| InChI | InChI=1S/C17H9N4.C9H8N2.Ir/c1-2-6-13-11(4-1)8-14-16-12(5-3-7-19-16)17-15(21(13)14)9-18-10-20-17;1-2-4-9(5-3-1)11-7-6-10-8-11;/h1-7,9-10H;1-4,6-8,10H;/q-1;-2;+3 |
| InChIKey | SAUSBEINMGNPJT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|