C18H17N3O2 — CID 153483601
5-(oxetan-3-yl)-3-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole (PubChem CID 153483601) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-(oxetan-3-yl)-3-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole.
| Compound Name | 5-(oxetan-3-yl)-3-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 153483601 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-(oxetan-3-yl)-3-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole |
| SMILES | c1ccc(COc2ccc(-c3n[nH]c(C4COC4)n3)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-4-13(5-3-1)10-23-16-8-6-14(7-9-16)17-19-18(21-20-17)15-11-22-12-15/h1-9,15H,10-12H2,(H,19,20,21) |
| InChIKey | GJNABVSWZXLXAW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |