C40H51F3IrNO2- — CID 153484552
1-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinoline;(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium (PubChem CID 153484552) has the molecular formula C40H51F3IrNO2- and a molecular weight of 827.06 g/mol. Its IUPAC name is 1-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinoline;(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium.
| Compound Name | 1-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinoline;(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium |
|---|---|
| PubChem CID | 153484552 |
| Molecular Formula | C40H51F3IrNO2- |
| Molecular Weight | 827.06 g/mol |
| Exact Mass | 827.35 |
| IUPAC Name | 1-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinoline;(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium |
| SMILES | Cc1[c-]c(-c2nccc3cc(CC(C)(C)C(F)(F)F)ccc23)cc(C(C)(C)C)c1.O=C(/C=C(\O)C1CCCCC1)C1CCCCC1.[Ir] |
| InChI | InChI=1S/C25H27F3N.C15H24O2.Ir/c1-16-11-19(14-20(12-16)23(2,3)4)22-21-8-7-17(13-18(21)9-10-29-22)15-24(5,6)25(26,27)28;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h7-10,12-14H,15H2,1-6H3;11-13,16H,1-10H2;/q-1;;/b;14-11-; |
| InChIKey | NPPIZYMWGAMICS-CKWHXWLXSA-N |
| XLogP | 11.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.06 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|