C38H43F3IrNO2- — CID 153484560
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(cyclopentylmethyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one (PubChem CID 153484560) has the molecular formula C38H43F3IrNO2- and a molecular weight of 794.98 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(cyclopentylmethyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(cyclopentylmethyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 153484560 |
| Molecular Formula | C38H43F3IrNO2- |
| Molecular Weight | 794.98 g/mol |
| Exact Mass | 795.29 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(cyclopentylmethyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one |
| SMILES | CC(C)/C(O)=C/C(=O)C(F)(F)F.Cc1cc(C)c2c(CC3CCCC3)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C31H34N.C7H9F3O2.Ir/c1-20-14-21(2)30-25(16-22-10-6-7-11-22)19-28(32-29(30)15-20)24-17-23-12-8-9-13-26(23)27(18-24)31(3,4)5;1-4(2)5(11)3-6(12)7(8,9)10;/h8-9,12-15,18-19,22H,6-7,10-11,16H2,1-5H3;3-4,11H,1-2H3;/q-1;;/b;5-3-; |
| InChIKey | AQYPLVGOMUCFEN-FMFSYIAASA-N |
| XLogP | 10.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.98 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|