C32H39F4IrN2O2- — CID 153484576
(Z)-6-ethyl-5-hydroxy-2-methyloct-4-en-3-one;4-(4-fluoro-3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium (PubChem CID 153484576) has the molecular formula C32H39F4IrN2O2- and a molecular weight of 751.88 g/mol. Its IUPAC name is (Z)-6-ethyl-5-hydroxy-2-methyloct-4-en-3-one;4-(4-fluoro-3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium.
| Compound Name | (Z)-6-ethyl-5-hydroxy-2-methyloct-4-en-3-one;4-(4-fluoro-3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium |
|---|---|
| PubChem CID | 153484576 |
| Molecular Formula | C32H39F4IrN2O2- |
| Molecular Weight | 751.88 g/mol |
| Exact Mass | 752.26 |
| IUPAC Name | (Z)-6-ethyl-5-hydroxy-2-methyloct-4-en-3-one;4-(4-fluoro-3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium |
| SMILES | CCC(CC)/C(O)=C/C(=O)C(C)C.Cc1[c-]c(-c2ncnc3cc(CC(C)(C)C(F)(F)F)ccc23)cc(C)c1F.[Ir] |
| InChI | InChI=1S/C21H19F4N2.C11H20O2.Ir/c1-12-7-15(8-13(2)18(12)22)19-16-6-5-14(9-17(16)26-11-27-19)10-20(3,4)21(23,24)25;1-5-9(6-2)11(13)7-10(12)8(3)4;/h5-7,9,11H,10H2,1-4H3;7-9,13H,5-6H2,1-4H3;/q-1;;/b;11-7-; |
| InChIKey | VEJDABXBKQIHEI-HUZFCYHXSA-N |
| XLogP | 9.07 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.88 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|