C34H44F3IrN2O2- — CID 153428524
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium (PubChem CID 153428524) has the molecular formula C34H44F3IrN2O2- and a molecular weight of 761.95 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium |
|---|---|
| PubChem CID | 153428524 |
| Molecular Formula | C34H44F3IrN2O2- |
| Molecular Weight | 761.95 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)quinazoline;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2ncnc3cc(CC(C)(C)C(F)(F)F)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C21H20F3N2.C13H24O2.Ir/c1-13-7-14(2)9-16(8-13)19-17-6-5-15(10-18(17)25-12-26-19)11-20(3,4)21(22,23)24;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-8,10,12H,11H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | NNHNTTUNONUGEK-DZTQYQPZSA-N |
| XLogP | 9.71 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.95 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|