C30H22F2N4O — CID 153485630
(5aR,6R,9aS)-2-(8-fluoro-2-methylquinolin-4-yl)-4-(2-fluorophenyl)-8-isocyano-6,9a-dimethyl-5a,6-dihydro-5H-indeno[1,2-d]pyrimidin-7-one (PubChem CID 153485630) has the molecular formula C30H22F2N4O and a molecular weight of 492.53 g/mol. Its IUPAC name is (5aR,6R,9aS)-2-(8-fluoro-2-methylquinolin-4-yl)-4-(2-fluorophenyl)-8-isocyano-6,9a-dimethyl-5a,6-dihydro-5H-indeno[1,2-d]pyrimidin-7-one.
| Compound Name | (5aR,6R,9aS)-2-(8-fluoro-2-methylquinolin-4-yl)-4-(2-fluorophenyl)-8-isocyano-6,9a-dimethyl-5a,6-dihydro-5H-indeno[1,2-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 153485630 |
| Molecular Formula | C30H22F2N4O |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (5aR,6R,9aS)-2-(8-fluoro-2-methylquinolin-4-yl)-4-(2-fluorophenyl)-8-isocyano-6,9a-dimethyl-5a,6-dihydro-5H-indeno[1,2-d]pyrimidin-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4cc(C)nc5c(F)cccc45)nc(-c4ccccc4F)c3C[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C30H22F2N4O/c1-15-12-19(17-9-7-11-23(32)26(17)34-15)29-35-25(18-8-5-6-10-22(18)31)20-13-21-16(2)27(37)24(33-4)14-30(21,3)28(20)36-29/h5-12,14,16,21H,13H2,1-3H3/t16-,21-,30-/m1/s1 |
| InChIKey | MAIDCFPMMIGCEY-OOKUUPAKSA-N |
| XLogP | 6.40 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|