C33H43N3O4 — CID 153485825
N-[[3-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]-[3-hydroxy-4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarboxamide (PubChem CID 153485825) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is N-[[3-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]-[3-hydroxy-4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[[3-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]-[3-hydroxy-4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 153485825 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | N-[[3-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]-[3-hydroxy-4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(C2CCC(C(NC(=O)C3CCCCC3)c3cccc(-c4cnn(CCO)c4)c3)CC2O)cc1C |
| InChI | InChI=1S/C33H43N3O4/c1-22-17-25(12-14-31(22)40-2)29-13-11-27(19-30(29)38)32(35-33(39)23-7-4-3-5-8-23)26-10-6-9-24(18-26)28-20-34-36(21-28)15-16-37/h6,9-10,12,14,17-18,20-21,23,27,29-30,32,37-38H,3-5,7-8,11,13,15-16,19H2,1-2H3,(H,35,39) |
| InChIKey | YFFUMFNVDPPYCZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |