C40H53N3O4 — CID 176883454
pentyl 1-[[[3-(1-cyclopropylpyrazol-4-yl)phenyl]-[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 176883454) has the molecular formula C40H53N3O4 and a molecular weight of 639.88 g/mol. Its IUPAC name is pentyl 1-[[[3-(1-cyclopropylpyrazol-4-yl)phenyl]-[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | pentyl 1-[[[3-(1-cyclopropylpyrazol-4-yl)phenyl]-[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 176883454 |
| Molecular Formula | C40H53N3O4 |
| Molecular Weight | 639.88 g/mol |
| Exact Mass | 639.40 |
| IUPAC Name | pentyl 1-[[[3-(1-cyclopropylpyrazol-4-yl)phenyl]-[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCOC(=O)C1(C(=O)NC(c2cccc(-c3cnn(C4CC4)c3)c2)C2CCC(c3ccc(OC)c(C)c3)CC2)CCCCC1 |
| InChI | InChI=1S/C40H53N3O4/c1-4-5-9-23-47-39(45)40(21-7-6-8-22-40)38(44)42-37(30-15-13-29(14-16-30)32-17-20-36(46-3)28(2)24-32)33-12-10-11-31(25-33)34-26-41-43(27-34)35-18-19-35/h10-12,17,20,24-27,29-30,35,37H,4-9,13-16,18-19,21-23H2,1-3H3,(H,42,44) |
| InChIKey | UIZPAPBAEOEUAP-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.88 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|