About (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine
(2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine (PubChem CID 153485962) has the molecular formula C17H35N3O
and a molecular weight of 297.49 g/mol. Its IUPAC name is (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine |
| PubChem CID | 153485962 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCO[C@@H](CN2CCN(CC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C17H35N3O/c1-15(2)20-10-11-21-16(13-20)12-18-6-8-19(9-7-18)14-17(3,4)5/h15-16H,6-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | RASDWNLPYCXOMW-INIZCTEOSA-N |
| XLogP | 1.76 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine?
The IUPAC name of (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine (CID 153485962) is (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine.
What is the SMILES notation for (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine?
The canonical SMILES for (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine is CC(C)N1CCO[C@@H](CN2CCN(CC(C)(C)C)CC2)C1.
What is the InChIKey of (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine?
The InChIKey is RASDWNLPYCXOMW-INIZCTEOSA-N. The full InChI is InChI=1S/C17H35N3O/c1-15(2)20-10-11-21-16(13-20)12-18-6-8-19(9-7-18)14-17(3,4)5/h15-16H,6-14H2,1-5H3/t16-/m0/s1.
What are the key properties of (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine?
(2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine has a molecular weight of 297.49 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[4-(2,2-dimethylpropyl)piperazin-1-yl]methyl]-4-propan-2-ylmorpholine is sourced from PubChem (CID 153485962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).