C15H30BrN3O — CID 80667744
2-[[4-(2-bromoethyl)-1,4-diazepan-1-yl]methyl]-4-propan-2-ylmorpholine (PubChem CID 80667744) has the molecular formula C15H30BrN3O and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[[4-(2-bromoethyl)-1,4-diazepan-1-yl]methyl]-4-propan-2-ylmorpholine.
| Compound Name | 2-[[4-(2-bromoethyl)-1,4-diazepan-1-yl]methyl]-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 80667744 |
| Molecular Formula | C15H30BrN3O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[[4-(2-bromoethyl)-1,4-diazepan-1-yl]methyl]-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOC(CN2CCCN(CCBr)CC2)C1 |
| InChI | InChI=1S/C15H30BrN3O/c1-14(2)19-10-11-20-15(13-19)12-18-6-3-5-17(7-4-16)8-9-18/h14-15H,3-13H2,1-2H3 |
| InChIKey | UHZHSLDHHBEZJE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|