C60H38N4 — CID 153486509
9-[5-(2,7-diphenylcarbazol-9-yl)-4-(3-isocyanophenyl)-3-pyridinyl]-2,7-diphenylcarbazole (PubChem CID 153486509) has the molecular formula C60H38N4 and a molecular weight of 814.99 g/mol. Its IUPAC name is 9-[5-(2,7-diphenylcarbazol-9-yl)-4-(3-isocyanophenyl)-3-pyridinyl]-2,7-diphenylcarbazole.
| Compound Name | 9-[5-(2,7-diphenylcarbazol-9-yl)-4-(3-isocyanophenyl)-3-pyridinyl]-2,7-diphenylcarbazole |
|---|---|
| PubChem CID | 153486509 |
| Molecular Formula | C60H38N4 |
| Molecular Weight | 814.99 g/mol |
| Exact Mass | 814.31 |
| IUPAC Name | 9-[5-(2,7-diphenylcarbazol-9-yl)-4-(3-isocyanophenyl)-3-pyridinyl]-2,7-diphenylcarbazole |
| SMILES | [C-]#[N+]c1cccc(-c2c(-n3c4cc(-c5ccccc5)ccc4c4ccc(-c5ccccc5)cc43)cncc2-n2c3cc(-c4ccccc4)ccc3c3ccc(-c4ccccc4)cc32)c1 |
| InChI | InChI=1S/C60H38N4/c1-61-49-24-14-23-48(33-49)60-58(63-54-34-44(40-15-6-2-7-16-40)25-29-50(54)51-30-26-45(35-55(51)63)41-17-8-3-9-18-41)38-62-39-59(60)64-56-36-46(42-19-10-4-11-20-42)27-31-52(56)53-32-28-47(37-57(53)64)43-21-12-5-13-22-43/h2-39H |
| InChIKey | BKSLTXFOBBXCEN-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 27.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.99 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|