C40H25N3 — CID 140768957
9-[3-(5-isocyano-3-pyridinyl)phenyl]-5,7-diphenylbenzo[c]carbazole (PubChem CID 140768957) has the molecular formula C40H25N3 and a molecular weight of 547.66 g/mol. Its IUPAC name is 9-[3-(5-isocyano-3-pyridinyl)phenyl]-5,7-diphenylbenzo[c]carbazole.
| Compound Name | 9-[3-(5-isocyano-3-pyridinyl)phenyl]-5,7-diphenylbenzo[c]carbazole |
|---|---|
| PubChem CID | 140768957 |
| Molecular Formula | C40H25N3 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 9-[3-(5-isocyano-3-pyridinyl)phenyl]-5,7-diphenylbenzo[c]carbazole |
| SMILES | [C-]#[N+]c1cncc(-c2cccc(-c3ccc4c5c6ccccc6c(-c6ccccc6)cc5n(-c5ccccc5)c4c3)c2)c1 |
| InChI | InChI=1S/C40H25N3/c1-41-32-22-31(25-42-26-32)29-14-10-13-28(21-29)30-19-20-36-38(23-30)43(33-15-6-3-7-16-33)39-24-37(27-11-4-2-5-12-27)34-17-8-9-18-35(34)40(36)39/h2-26H |
| InChIKey | HQKOIHONLJEUEP-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|