C46H48BFN10O12P2+ — CID 153488494
CID 153488494 (PubChem CID 153488494) has the molecular formula C46H48BFN10O12P2+ and a molecular weight of 1024.71 g/mol.
| Compound Name | CID 153488494 |
|---|---|
| PubChem CID | 153488494 |
| Molecular Formula | C46H48BFN10O12P2+ |
| Molecular Weight | 1024.71 g/mol |
| Exact Mass | 1024.30 |
| IUPAC Name | — |
| SMILES | [B-][P+](OCC[N+]#[C-])(OCCn1c(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)nc2cncnc21)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)[C@H](O[P+](=O)O)[C@@H]1F |
| InChI | InChI=1S/C46H46BFN10O12P2/c1-28(2)42(59)55-45-54-41-38(43(60)56-45)52-27-58(41)44-39(70-71(61)62)37(48)35(69-44)24-68-72(47,66-21-19-49-3)67-22-20-57-36(53-34-23-50-26-51-40(34)57)25-65-46(29-9-7-6-8-10-29,30-11-15-32(63-4)16-12-30)31-13-17-33(64-5)18-14-31/h6-18,23,26-28,35,37,39,44H,19-22,24-25H2,1-2,4-5H3,(H-2,54,55,56,59,60,61,62)/q-1/p+2/t35-,37-,39-,44-,72?/m1/s1 |
| InChIKey | FVBDDFHQNJSEID-AZFKJUMTSA-P |
| XLogP | 6.17 |
| TPSA | 251.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|