C25H30BFN10O10P2+ — CID 153488546
CID 153488546 (PubChem CID 153488546) has the molecular formula C25H30BFN10O10P2+ and a molecular weight of 722.33 g/mol.
| Compound Name | CID 153488546 |
|---|---|
| PubChem CID | 153488546 |
| Molecular Formula | C25H30BFN10O10P2+ |
| Molecular Weight | 722.33 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | — |
| SMILES | [B-][P+](OCC[N+]#[C-])(OCCn1c(CO)nc2cncnc21)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)[C@H](O[P+](=O)O)[C@@H]1F |
| InChI | InChI=1S/C25H28BFN10O10P2/c1-13(2)22(39)34-25-33-21-18(23(40)35-25)31-12-37(21)24-19(47-48(41)42)17(27)15(46-24)10-45-49(26,43-6-4-28-3)44-7-5-36-16(9-38)32-14-8-29-11-30-20(14)36/h8,11-13,15,17,19,24,38H,4-7,9-10H2,1-2H3,(H-2,33,34,35,39,40,41,42)/q-1/p+2/t15-,17-,19-,24-,49?/m1/s1 |
| InChIKey | ROLXCCZCGDFSCW-GBVHMISISA-P |
| XLogP | 1.13 |
| TPSA | 244.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|