C29H51N3O7 — CID 153491267
[1-[4-[3-(2-hydroxyethoxy)-3-oxopropyl]triazol-1-yl]-3-nonanoyloxypropan-2-yl] decanoate (PubChem CID 153491267) has the molecular formula C29H51N3O7 and a molecular weight of 553.74 g/mol. Its IUPAC name is [1-[4-[3-(2-hydroxyethoxy)-3-oxopropyl]triazol-1-yl]-3-nonanoyloxypropan-2-yl] decanoate.
| Compound Name | [1-[4-[3-(2-hydroxyethoxy)-3-oxopropyl]triazol-1-yl]-3-nonanoyloxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 153491267 |
| Molecular Formula | C29H51N3O7 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.37 |
| IUPAC Name | [1-[4-[3-(2-hydroxyethoxy)-3-oxopropyl]triazol-1-yl]-3-nonanoyloxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC)Cn1cc(CCC(=O)OCCO)nn1 |
| InChI | InChI=1S/C29H51N3O7/c1-3-5-7-9-11-13-15-17-29(36)39-26(24-38-27(34)16-14-12-10-8-6-4-2)23-32-22-25(30-31-32)18-19-28(35)37-21-20-33/h22,26,33H,3-21,23-24H2,1-2H3 |
| InChIKey | RZHBAORSCWIBMX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|