C38H71N3O7 — CID 145405780
[2-decanoyloxy-3-[4-[4-(3-hydroxy-3-methylbutoxy)-4-methyl-3-oxopentyl]triazol-1-yl]propyl] decanoate;ethane (PubChem CID 145405780) has the molecular formula C38H71N3O7 and a molecular weight of 682.00 g/mol. Its IUPAC name is [2-decanoyloxy-3-[4-[4-(3-hydroxy-3-methylbutoxy)-4-methyl-3-oxopentyl]triazol-1-yl]propyl] decanoate;ethane.
| Compound Name | [2-decanoyloxy-3-[4-[4-(3-hydroxy-3-methylbutoxy)-4-methyl-3-oxopentyl]triazol-1-yl]propyl] decanoate;ethane |
|---|---|
| PubChem CID | 145405780 |
| Molecular Formula | C38H71N3O7 |
| Molecular Weight | 682.00 g/mol |
| Exact Mass | 681.53 |
| IUPAC Name | [2-decanoyloxy-3-[4-[4-(3-hydroxy-3-methylbutoxy)-4-methyl-3-oxopentyl]triazol-1-yl]propyl] decanoate;ethane |
| SMILES | CC.CCCCCCCCCC(=O)OCC(Cn1cc(CCC(=O)C(C)(C)OCCC(C)(C)O)nn1)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C36H65N3O7.C2H6/c1-7-9-11-13-15-17-19-21-33(41)44-29-31(46-34(42)22-20-18-16-14-12-10-8-2)28-39-27-30(37-38-39)23-24-32(40)36(5,6)45-26-25-35(3,4)43;1-2/h27,31,43H,7-26,28-29H2,1-6H3;1-2H3 |
| InChIKey | QHGJAWQELYZAIL-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.00 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|