C25H37N3O7 — CID 153492387
methyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]-2-(cyclopentanecarbonylamino)propanoate (PubChem CID 153492387) has the molecular formula C25H37N3O7 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]-2-(cyclopentanecarbonylamino)propanoate.
| Compound Name | methyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]-2-(cyclopentanecarbonylamino)propanoate |
|---|---|
| PubChem CID | 153492387 |
| Molecular Formula | C25H37N3O7 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | methyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]-2-(cyclopentanecarbonylamino)propanoate |
| SMILES | COC(=O)C(Cc1ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc1)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C25H37N3O7/c1-24(2,3)34-22(31)28(23(32)35-25(4,5)6)19-13-12-16(15-26-19)14-18(21(30)33-7)27-20(29)17-10-8-9-11-17/h12-13,15,17-18H,8-11,14H2,1-7H3,(H,27,29) |
| InChIKey | KTDVAXOWPLUZMZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|