C36H22IrN2O-2 — CID 153493012
iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;3-(3H-phenanthren-3-id-2-yl)-1,2-benzoxazole (PubChem CID 153493012) has the molecular formula C36H22IrN2O-2 and a molecular weight of 690.80 g/mol. Its IUPAC name is iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;3-(3H-phenanthren-3-id-2-yl)-1,2-benzoxazole.
| Compound Name | iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;3-(3H-phenanthren-3-id-2-yl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493012 |
| Molecular Formula | C36H22IrN2O-2 |
| Molecular Weight | 690.80 g/mol |
| Exact Mass | 691.14 |
| IUPAC Name | iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;3-(3H-phenanthren-3-id-2-yl)-1,2-benzoxazole |
| SMILES | [Ir].[c-]1cc2c(ccc3ccccc32)cc1-c1noc2ccccc12.[c-]1ccc2ccccc2c1-c1ccccn1 |
| InChI | InChI=1S/C21H12NO.C15H10N.Ir/c1-2-6-17-14(5-1)9-10-15-13-16(11-12-18(15)17)21-19-7-3-4-8-20(19)23-22-21;1-2-8-13-12(6-1)7-5-9-14(13)15-10-3-4-11-16-15;/h1-10,12-13H;1-8,10-11H;/q2*-1; |
| InChIKey | NAQNHHDYKNEOFE-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.80 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|