C41H34IrN4O-2 — CID 153493035
6-hexyl-1,9-dipyridin-2-yl-2H-carbazol-2-ide;iridium;3-phenyl-1,2-benzoxazole (PubChem CID 153493035) has the molecular formula C41H34IrN4O-2 and a molecular weight of 790.97 g/mol. Its IUPAC name is 6-hexyl-1,9-dipyridin-2-yl-2H-carbazol-2-ide;iridium;3-phenyl-1,2-benzoxazole.
| Compound Name | 6-hexyl-1,9-dipyridin-2-yl-2H-carbazol-2-ide;iridium;3-phenyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493035 |
| Molecular Formula | C41H34IrN4O-2 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 791.24 |
| IUPAC Name | 6-hexyl-1,9-dipyridin-2-yl-2H-carbazol-2-ide;iridium;3-phenyl-1,2-benzoxazole |
| SMILES | CCCCCCc1ccc2c(c1)c1cc[c-]c(-c3ccccn3)c1n2-c1ccccn1.[Ir].[c-]1ccccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C28H26N3.C13H8NO.Ir/c1-2-3-4-5-11-21-16-17-26-24(20-21)22-12-10-13-23(25-14-6-8-18-29-25)28(22)31(26)27-15-7-9-19-30-27;1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13;/h6-10,12,14-20H,2-5,11H2,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | LCJMLHBWOOQSPB-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|