C19H19ClFN5O3S2 — CID 153493162
(3S,5R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trideuterio-1,1-dioxo-2-(trideuteriomethyl)-5-[5-[1-(trideuteriomethyl)imidazol-4-yl]thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 153493162) has the molecular formula C19H19ClFN5O3S2 and a molecular weight of 493.03 g/mol. Its IUPAC name is (3S,5R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trideuterio-1,1-dioxo-2-(trideuteriomethyl)-5-[5-[1-(trideuteriomethyl)imidazol-4-yl]thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trideuterio-1,1-dioxo-2-(trideuteriomethyl)-5-[5-[1-(trideuteriomethyl)imidazol-4-yl]thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 153493162 |
| Molecular Formula | C19H19ClFN5O3S2 |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-3,4,5-trideuterio-1,1-dioxo-2-(trideuteriomethyl)-5-[5-[1-(trideuteriomethyl)imidazol-4-yl]thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | [2H]C1[C@]([2H])(c2ccc(-c3cn(C([2H])([2H])[2H])cn3)s2)NS(=O)(=O)N(C([2H])([2H])[2H])[C@]1([2H])C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClFN5O3S2/c1-25-9-15(22-10-25)18-6-5-17(30-18)14-8-16(26(2)31(28,29)24-14)19(27)23-11-3-4-13(21)12(20)7-11/h3-7,9-10,14,16,24H,8H2,1-2H3,(H,23,27)/t14-,16+/m1/s1/i1D3,2D3,8D,14D,16D/t8?,14-,16+ |
| InChIKey | JJGVJKWFQABPFU-DUVFSGEZSA-N |
| XLogP | 3.16 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |