C27H22N3O2P — CID 153495046
2-[10-[3-(3-methyl-2H-imidazol-1-yl)phenyl]phenoxaphosphinin-2-yl]oxypyridine (PubChem CID 153495046) has the molecular formula C27H22N3O2P and a molecular weight of 451.47 g/mol. Its IUPAC name is 2-[10-[3-(3-methyl-2H-imidazol-1-yl)phenyl]phenoxaphosphinin-2-yl]oxypyridine.
| Compound Name | 2-[10-[3-(3-methyl-2H-imidazol-1-yl)phenyl]phenoxaphosphinin-2-yl]oxypyridine |
|---|---|
| PubChem CID | 153495046 |
| Molecular Formula | C27H22N3O2P |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[10-[3-(3-methyl-2H-imidazol-1-yl)phenyl]phenoxaphosphinin-2-yl]oxypyridine |
| SMILES | CN1C=CN(c2cccc(P3c4ccccc4Oc4ccc(Oc5ccccn5)cc43)c2)C1 |
| InChI | InChI=1S/C27H22N3O2P/c1-29-15-16-30(19-29)20-7-6-8-22(17-20)33-25-10-3-2-9-23(25)32-24-13-12-21(18-26(24)33)31-27-11-4-5-14-28-27/h2-18H,19H2,1H3 |
| InChIKey | ACZQPFMTDYHZSJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|