C36H21BN4PtS — CID 153495350
CID 153495350 (PubChem CID 153495350) has the molecular formula C36H21BN4PtS and a molecular weight of 747.55 g/mol.
| Compound Name | CID 153495350 |
|---|---|
| PubChem CID | 153495350 |
| Molecular Formula | C36H21BN4PtS |
| Molecular Weight | 747.55 g/mol |
| Exact Mass | 747.12 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(-c2nccs2)ccc2c1B1c3[c-]c(-n4cc(-c5ccccc5)cn4)ccc3-c3ccccc3N1c1ccccc1-2 |
| InChI | InChI=1S/C36H21BN4S.Pt/c1-2-8-24(9-3-1)26-22-39-40(23-26)27-15-17-29-31-11-5-7-13-35(31)41-34-12-6-4-10-30(34)28-16-14-25(36-38-18-19-42-36)20-32(28)37(41)33(29)21-27;/h1-19,22-23H;/q-2;+2 |
| InChIKey | DQQODDJYYUSAFS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|