C26H25N7O — CID 153496332
3-[(S)-cyclopropyl-[(2,6-diamino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-methyl-2-(2-methylphenyl)isoquinolin-1-one (PubChem CID 153496332) has the molecular formula C26H25N7O and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[(S)-cyclopropyl-[(2,6-diamino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-methyl-2-(2-methylphenyl)isoquinolin-1-one.
| Compound Name | 3-[(S)-cyclopropyl-[(2,6-diamino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-methyl-2-(2-methylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 153496332 |
| Molecular Formula | C26H25N7O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[(S)-cyclopropyl-[(2,6-diamino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-methyl-2-(2-methylphenyl)isoquinolin-1-one |
| SMILES | [C-]#[N+]c1c(N)nc(N)nc1N[C@H](c1cc2cccc(C)c2c(=O)n1-c1ccccc1C)C1CC1 |
| InChI | InChI=1S/C26H25N7O/c1-14-7-4-5-10-18(14)33-19(13-17-9-6-8-15(2)20(17)25(33)34)21(16-11-12-16)30-24-22(29-3)23(27)31-26(28)32-24/h4-10,13,16,21H,11-12H2,1-2H3,(H5,27,28,30,31,32)/t21-/m0/s1 |
| InChIKey | UUXDFELKOSNRHV-NRFANRHFSA-N |
| XLogP | 4.68 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|