C43H36BNO3S — CID 153497995
9-methyl-N,N-diphenyl-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-2-yl]dibenzofuran-2-amine (PubChem CID 153497995) has the molecular formula C43H36BNO3S and a molecular weight of 657.64 g/mol. Its IUPAC name is 9-methyl-N,N-diphenyl-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-2-yl]dibenzofuran-2-amine.
| Compound Name | 9-methyl-N,N-diphenyl-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-2-yl]dibenzofuran-2-amine |
|---|---|
| PubChem CID | 153497995 |
| Molecular Formula | C43H36BNO3S |
| Molecular Weight | 657.64 g/mol |
| Exact Mass | 657.25 |
| IUPAC Name | 9-methyl-N,N-diphenyl-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-2-yl]dibenzofuran-2-amine |
| SMILES | Cc1cccc2oc3c(-c4ccc5sc6ccc(B7OC(C)(C)C(C)(C)O7)cc6c5c4)cc(N(c4ccccc4)c4ccccc4)cc3c12 |
| InChI | InChI=1S/C43H36BNO3S/c1-27-13-12-18-37-40(27)36-26-32(45(30-14-8-6-9-15-30)31-16-10-7-11-17-31)25-33(41(36)46-37)28-19-21-38-34(23-28)35-24-29(20-22-39(35)49-38)44-47-42(2,3)43(4,5)48-44/h6-26H,1-5H3 |
| InChIKey | YFPXYRIGHLCXFR-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.64 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|