C19H14ClN5S — CID 15350622
6-(2-chloroquinolin-3-yl)-3-(2-methylphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 15350622) has the molecular formula C19H14ClN5S and a molecular weight of 379.88 g/mol. Its IUPAC name is 6-(2-chloroquinolin-3-yl)-3-(2-methylphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2-chloroquinolin-3-yl)-3-(2-methylphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 15350622 |
| Molecular Formula | C19H14ClN5S |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 6-(2-chloroquinolin-3-yl)-3-(2-methylphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1ccccc1-c1nnc2n1NC(c1cc3ccccc3nc1Cl)S2 |
| InChI | InChI=1S/C19H14ClN5S/c1-11-6-2-4-8-13(11)17-22-23-19-25(17)24-18(26-19)14-10-12-7-3-5-9-15(12)21-16(14)20/h2-10,18,24H,1H3 |
| InChIKey | OGACDWXIKIQDHU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|