About 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene
2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene (PubChem CID 15351395) has the molecular formula C33H31IP2Pd
and a molecular weight of 722.88 g/mol. Its IUPAC name is 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene.
Molecular Properties
| Compound Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene |
| PubChem CID | 15351395 |
| Molecular Formula | C33H31IP2Pd |
| Molecular Weight | 722.88 g/mol |
| Exact Mass | 722.00 |
| IUPAC Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene |
| SMILES | Cc1cc[c-]cc1.[Pd+]I.c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2.C7H7.HI.Pd/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;1-7-5-3-2-4-6-7;;/h1-20H,21-22H2;3-6H,1H3;1H;/q;-1;;+2/p-1 |
| InChIKey | UQTFEVXXCUKVTA-UHFFFAOYSA-M |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 722.88 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene?
The IUPAC name of 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene (CID 15351395) is 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene.
What is the SMILES notation for 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene?
The canonical SMILES for 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene is Cc1cc[c-]cc1.[Pd+]I.c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene?
The InChIKey is UQTFEVXXCUKVTA-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H24P2.C7H7.HI.Pd/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;1-7-5-3-2-4-6-7;;/h1-20H,21-22H2;3-6H,1H3;1H;/q;-1;;+2/p-1.
What are the key properties of 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene?
2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene has a molecular weight of 722.88 g/mol, XLogP of 7.93, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphanylethyl(diphenyl)phosphane;iodopalladium(1+);methylbenzene is sourced from PubChem (CID 15351395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).