C8H13F2NO2 — CID 15352259
3-tert-butyl-5-(difluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 15352259) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is 3-tert-butyl-5-(difluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-tert-butyl-5-(difluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 15352259 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-tert-butyl-5-(difluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | CC(C)(C)C1=NOC(O)(C(F)F)C1 |
| InChI | InChI=1S/C8H13F2NO2/c1-7(2,3)5-4-8(12,6(9)10)13-11-5/h6,12H,4H2,1-3H3 |
| InChIKey | UWWKTFWXQMBUEZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |