C8H12F3NO2 — CID 7111782
(5R)-3-tert-butyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 7111782) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is (5R)-3-tert-butyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | (5R)-3-tert-butyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 7111782 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (5R)-3-tert-butyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | CC(C)(C)C1=NO[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H12F3NO2/c1-6(2,3)5-4-7(13,14-12-5)8(9,10)11/h13H,4H2,1-3H3/t7-/m1/s1 |
| InChIKey | VOMBRBSMTPDXFK-SSDOTTSWSA-N |
| XLogP | 2.06 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |