C12H18O2 — CID 15352879
(4aS,7S)-7-methoxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 15352879) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (4aS,7S)-7-methoxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS,7S)-7-methoxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 15352879 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (4aS,7S)-7-methoxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CO[C@H]1CC[C@@]2(C)CCC(=O)C=C2C1 |
| InChI | InChI=1S/C12H18O2/c1-12-5-3-10(13)7-9(12)8-11(14-2)4-6-12/h7,11H,3-6,8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | ATZFXHQDWVLDGR-NWDGAFQWSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |