C20H44B2N6S — CID 15361369
bis[(1,3-dibutyl-1,3,2-diazaborolidin-2-yl)imino]-λ4-sulfane (PubChem CID 15361369) has the molecular formula C20H44B2N6S and a molecular weight of 422.31 g/mol. Its IUPAC name is bis[(1,3-dibutyl-1,3,2-diazaborolidin-2-yl)imino]-λ4-sulfane.
| Compound Name | bis[(1,3-dibutyl-1,3,2-diazaborolidin-2-yl)imino]-λ4-sulfane |
|---|---|
| PubChem CID | 15361369 |
| Molecular Formula | C20H44B2N6S |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | bis[(1,3-dibutyl-1,3,2-diazaborolidin-2-yl)imino]-λ4-sulfane |
| SMILES | CCCCN1CCN(CCCC)B1N=S=NB1N(CCCC)CCN1CCCC |
| InChI | InChI=1S/C20H44B2N6S/c1-5-9-13-25-17-18-26(14-10-6-2)21(25)23-29-24-22-27(15-11-7-3)19-20-28(22)16-12-8-4/h5-20H2,1-4H3 |
| InChIKey | GDNVNYHBZHIKNP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|