About cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate)
cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) (PubChem CID 15364197) has the molecular formula C28H20CdN2O4
and a molecular weight of 560.89 g/mol. Its IUPAC name is cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate).
Molecular Properties
| Compound Name | cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) |
| PubChem CID | 15364197 |
| Molecular Formula | C28H20CdN2O4 |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) |
| SMILES | O=C([O-])c1cccc(/C=C/c2ccncc2)c1.O=C([O-])c1cccc(/C=C/c2ccncc2)c1.[Cd+2] |
| InChI | InChI=1S/2C14H11NO2.Cd/c2*16-14(17)13-3-1-2-12(10-13)5-4-11-6-8-15-9-7-11;/h2*1-10H,(H,16,17);/q;;+2/p-2/b2*5-4+; |
| InChIKey | JHIUCMQZTOXFRA-WDTNTSJCSA-L |
| XLogP | 3.23 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate)?
The IUPAC name of cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) (CID 15364197) is cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate).
What is the SMILES notation for cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate)?
The canonical SMILES for cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) is O=C([O-])c1cccc(/C=C/c2ccncc2)c1.O=C([O-])c1cccc(/C=C/c2ccncc2)c1.[Cd+2].
What is the InChIKey of cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate)?
The InChIKey is JHIUCMQZTOXFRA-WDTNTSJCSA-L. The full InChI is InChI=1S/2C14H11NO2.Cd/c2*16-14(17)13-3-1-2-12(10-13)5-4-11-6-8-15-9-7-11;/h2*1-10H,(H,16,17);/q;;+2/p-2/b2*5-4+;.
What are the key properties of cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate)?
cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) has a molecular weight of 560.89 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(3-[(E)-2-pyridin-4-ylethenyl]benzoate) is sourced from PubChem (CID 15364197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).