C29H23N3O3S — CID 15364860
4-methyl-N-(6-oxo-1,4,5-triphenylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 15364860) has the molecular formula C29H23N3O3S and a molecular weight of 493.59 g/mol. Its IUPAC name is 4-methyl-N-(6-oxo-1,4,5-triphenylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(6-oxo-1,4,5-triphenylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 15364860 |
| Molecular Formula | C29H23N3O3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 4-methyl-N-(6-oxo-1,4,5-triphenylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc(-c3ccccc3)c(-c3ccccc3)c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23N3O3S/c1-21-17-19-25(20-18-21)36(34,35)31-29-30-27(23-13-7-3-8-14-23)26(22-11-5-2-6-12-22)28(33)32(29)24-15-9-4-10-16-24/h2-20H,1H3,(H,30,31) |
| InChIKey | DQPYZQFKFOQDBT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |