C18H21F2N5O3 — CID 15378545
1-cyclopropyl-6,8-difluoro-5-hydrazinyl-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 15378545) has the molecular formula C18H21F2N5O3 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1-cyclopropyl-6,8-difluoro-5-hydrazinyl-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6,8-difluoro-5-hydrazinyl-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 15378545 |
| Molecular Formula | C18H21F2N5O3 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-cyclopropyl-6,8-difluoro-5-hydrazinyl-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CN1CCN(c2c(F)c(NN)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)CC1 |
| InChI | InChI=1S/C18H21F2N5O3/c1-23-4-6-24(7-5-23)16-12(19)14(22-21)11-15(13(16)20)25(9-2-3-9)8-10(17(11)26)18(27)28/h8-9,22H,2-7,21H2,1H3,(H,27,28) |
| InChIKey | NXRHPSUJGFDEFZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|