About (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate
(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate (PubChem CID 15379325) has the molecular formula C16H15NO6
and a molecular weight of 317.30 g/mol. Its IUPAC name is (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate.
Molecular Properties
| Compound Name | (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate |
| PubChem CID | 15379325 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate |
| SMILES | COC(=O)Cc1cc(OC)ccc1C(=O)On1ccccc1=O |
| InChI | InChI=1S/C16H15NO6/c1-21-12-6-7-13(11(9-12)10-15(19)22-2)16(20)23-17-8-4-3-5-14(17)18/h3-9H,10H2,1-2H3 |
| InChIKey | KGDVVZNNWOPPGJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
The IUPAC name of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate (CID 15379325) is (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate.
What is the SMILES notation for (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
The canonical SMILES for (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate is COC(=O)Cc1cc(OC)ccc1C(=O)On1ccccc1=O.
What is the InChIKey of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
The InChIKey is KGDVVZNNWOPPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO6/c1-21-12-6-7-13(11(9-12)10-15(19)22-2)16(20)23-17-8-4-3-5-14(17)18/h3-9H,10H2,1-2H3.
What are the key properties of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate has a molecular weight of 317.30 g/mol, XLogP of 0.84, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate is sourced from PubChem (CID 15379325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).