(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate

C16H15NO6 — CID 15379325

IUPAC(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate
SMILESCOC(=O)Cc1cc(OC)ccc1C(=O)On1ccccc1=O
InChIInChI=1S/C16H15NO6/c1-21-12-6-7-13(11(9-12)10-15(19)22-2)16(20)23-17-8-4-3-5-14(17)18/h3-9H,10H2,1-2H3
InChIKeyKGDVVZNNWOPPGJ-UHFFFAOYSA-N
MW317.30 g/mol
LogP0.84
Rot. Bonds5

About (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate

(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate (PubChem CID 15379325) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate.

Molecular Properties

Compound Name(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate
PubChem CID15379325
Molecular FormulaC16H15NO6
Molecular Weight317.30 g/mol
Exact Mass317.09
IUPAC Name(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate
SMILESCOC(=O)Cc1cc(OC)ccc1C(=O)On1ccccc1=O
InChIInChI=1S/C16H15NO6/c1-21-12-6-7-13(11(9-12)10-15(19)22-2)16(20)23-17-8-4-3-5-14(17)18/h3-9H,10H2,1-2H3
InChIKeyKGDVVZNNWOPPGJ-UHFFFAOYSA-N
XLogP0.84
TPSA83.83 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.30
LogP ≤ 50.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
The IUPAC name of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate (CID 15379325) is (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate.
What is the SMILES notation for (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
The canonical SMILES for (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate is COC(=O)Cc1cc(OC)ccc1C(=O)On1ccccc1=O.
What is the InChIKey of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
The InChIKey is KGDVVZNNWOPPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO6/c1-21-12-6-7-13(11(9-12)10-15(19)22-2)16(20)23-17-8-4-3-5-14(17)18/h3-9H,10H2,1-2H3.
What are the key properties of (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate?
(2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate has a molecular weight of 317.30 g/mol, XLogP of 0.84, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-pyridinyl) 4-methoxy-2-(2-methoxy-2-oxoethyl)benzoate is sourced from PubChem (CID 15379325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).