About 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate
4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 15380467) has the molecular formula C24H35NO5
and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| PubChem CID | 15380467 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OCCCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H35NO5/c1-5-24(2,3)21(26)22(27)25-16-8-6-11-20(25)23(28)30-17-9-7-10-18-12-14-19(29-4)15-13-18/h12-15,20H,5-11,16-17H2,1-4H3 |
| InChIKey | INXPEFDXUAPBRR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
The IUPAC name of 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (CID 15380467) is 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
What is the SMILES notation for 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
The canonical SMILES for 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate is CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OCCCCc1ccc(OC)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
The InChIKey is INXPEFDXUAPBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NO5/c1-5-24(2,3)21(26)22(27)25-16-8-6-11-20(25)23(28)30-17-9-7-10-18-12-14-19(29-4)15-13-18/h12-15,20H,5-11,16-17H2,1-4H3.
What are the key properties of 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate has a molecular weight of 417.55 g/mol, XLogP of 3.95, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)butyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate is sourced from PubChem (CID 15380467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).