C40H48F3N5O3 — CID 15383064
N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-6-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-N-pyridin-2-ylhexanamide (PubChem CID 15383064) has the molecular formula C40H48F3N5O3 and a molecular weight of 703.85 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-6-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-N-pyridin-2-ylhexanamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-6-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-N-pyridin-2-ylhexanamide |
|---|---|
| PubChem CID | 15383064 |
| Molecular Formula | C40H48F3N5O3 |
| Molecular Weight | 703.85 g/mol |
| Exact Mass | 703.37 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-6-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-N-pyridin-2-ylhexanamide |
| SMILES | COc1ccccc1N1CCN(CCN(C(=O)CCCCCNCCC(Oc2ccc(C(F)(F)F)cc2)c2ccccc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C40H48F3N5O3/c1-50-37-15-8-7-14-35(37)47-29-26-46(27-30-47)28-31-48(38-16-9-11-24-45-38)39(49)17-6-3-10-23-44-25-22-36(32-12-4-2-5-13-32)51-34-20-18-33(19-21-34)40(41,42)43/h2,4-5,7-9,11-16,18-21,24,36,44H,3,6,10,17,22-23,25-31H2,1H3 |
| InChIKey | NZDWIWWLRWWWSM-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.85 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|