C11H18N2O5 — CID 15383872
methyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-2-enoate (PubChem CID 15383872) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is methyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-2-enoate.
| Compound Name | methyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 15383872 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | methyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-2-enoate |
| SMILES | C=C(NC(=O)CNC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C11H18N2O5/c1-7(9(15)17-5)13-8(14)6-12-10(16)18-11(2,3)4/h1,6H2,2-5H3,(H,12,16)(H,13,14) |
| InChIKey | RLTJINFZQCECSP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|