C14H9FO5 — CID 15385144
ethyl 5-fluoro-2-oxofuro[2,3-h]chromene-8-carboxylate (PubChem CID 15385144) has the molecular formula C14H9FO5 and a molecular weight of 276.22 g/mol. Its IUPAC name is ethyl 5-fluoro-2-oxofuro[2,3-h]chromene-8-carboxylate.
| Compound Name | ethyl 5-fluoro-2-oxofuro[2,3-h]chromene-8-carboxylate |
|---|---|
| PubChem CID | 15385144 |
| Molecular Formula | C14H9FO5 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | ethyl 5-fluoro-2-oxofuro[2,3-h]chromene-8-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cc(F)c3ccc(=O)oc32)o1 |
| InChI | InChI=1S/C14H9FO5/c1-2-18-14(17)11-5-8-10(19-11)6-9(15)7-3-4-12(16)20-13(7)8/h3-6H,2H2,1H3 |
| InChIKey | JXZXYPZUACWKQK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|