C13H18NO6PS — CID 15388917
4-benzyl-2-(dimethoxyphosphorylmethyl)-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 15388917) has the molecular formula C13H18NO6PS and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-benzyl-2-(dimethoxyphosphorylmethyl)-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 4-benzyl-2-(dimethoxyphosphorylmethyl)-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 15388917 |
| Molecular Formula | C13H18NO6PS |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-benzyl-2-(dimethoxyphosphorylmethyl)-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | COP(=O)(CN1C(=O)C(Cc2ccccc2)CS1(=O)=O)OC |
| InChI | InChI=1S/C13H18NO6PS/c1-19-21(16,20-2)10-14-13(15)12(9-22(14,17)18)8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3 |
| InChIKey | IBFKAIJSQNNZHL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|