C21H24NO5P — CID 45379155
(1S,9R,9aR)-9-(dimethoxyphosphorylmethyl)-1-phenylmethoxy-1,4,9,9a-tetrahydroazeto[1,2-b]isoquinolin-2-one (PubChem CID 45379155) has the molecular formula C21H24NO5P and a molecular weight of 401.40 g/mol. Its IUPAC name is (1S,9R,9aR)-9-(dimethoxyphosphorylmethyl)-1-phenylmethoxy-1,4,9,9a-tetrahydroazeto[1,2-b]isoquinolin-2-one.
| Compound Name | (1S,9R,9aR)-9-(dimethoxyphosphorylmethyl)-1-phenylmethoxy-1,4,9,9a-tetrahydroazeto[1,2-b]isoquinolin-2-one |
|---|---|
| PubChem CID | 45379155 |
| Molecular Formula | C21H24NO5P |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (1S,9R,9aR)-9-(dimethoxyphosphorylmethyl)-1-phenylmethoxy-1,4,9,9a-tetrahydroazeto[1,2-b]isoquinolin-2-one |
| SMILES | COP(=O)(C[C@@H]1c2ccccc2CN2C(=O)[C@@H](OCc3ccccc3)[C@@H]12)OC |
| InChI | InChI=1S/C21H24NO5P/c1-25-28(24,26-2)14-18-17-11-7-6-10-16(17)12-22-19(18)20(21(22)23)27-13-15-8-4-3-5-9-15/h3-11,18-20H,12-14H2,1-2H3/t18-,19-,20+/m1/s1 |
| InChIKey | OCNHJCBGSALQKA-AQNXPRMDSA-N |
| XLogP | 3.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|