C26H48NO3P — CID 15389102
N-benzyl-2-[bis(2-ethylhexoxy)phosphoryl]propan-2-amine (PubChem CID 15389102) has the molecular formula C26H48NO3P and a molecular weight of 453.65 g/mol. Its IUPAC name is N-benzyl-2-[bis(2-ethylhexoxy)phosphoryl]propan-2-amine.
| Compound Name | N-benzyl-2-[bis(2-ethylhexoxy)phosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 15389102 |
| Molecular Formula | C26H48NO3P |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | N-benzyl-2-[bis(2-ethylhexoxy)phosphoryl]propan-2-amine |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)C(C)(C)NCc1ccccc1 |
| InChI | InChI=1S/C26H48NO3P/c1-7-11-16-23(9-3)21-29-31(28,30-22-24(10-4)17-12-8-2)26(5,6)27-20-25-18-14-13-15-19-25/h13-15,18-19,23-24,27H,7-12,16-17,20-22H2,1-6H3 |
| InChIKey | JNGIKIMXZNPEQV-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|