C24H44NO3P — CID 15389105
N-[bis(2-ethylhexoxy)phosphorylmethyl]-1-phenylmethanamine (PubChem CID 15389105) has the molecular formula C24H44NO3P and a molecular weight of 425.59 g/mol. Its IUPAC name is N-[bis(2-ethylhexoxy)phosphorylmethyl]-1-phenylmethanamine.
| Compound Name | N-[bis(2-ethylhexoxy)phosphorylmethyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 15389105 |
| Molecular Formula | C24H44NO3P |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | N-[bis(2-ethylhexoxy)phosphorylmethyl]-1-phenylmethanamine |
| SMILES | CCCCC(CC)COP(=O)(CNCc1ccccc1)OCC(CC)CCCC |
| InChI | InChI=1S/C24H44NO3P/c1-5-9-14-22(7-3)19-27-29(26,28-20-23(8-4)15-10-6-2)21-25-18-24-16-12-11-13-17-24/h11-13,16-17,22-23,25H,5-10,14-15,18-21H2,1-4H3 |
| InChIKey | LVBQHEZTRANWSB-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|