C21H36F2O2 — CID 15389999
2,2-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]-1,3-dioxane (PubChem CID 15389999) has the molecular formula C21H36F2O2 and a molecular weight of 358.51 g/mol. Its IUPAC name is 2,2-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]-1,3-dioxane.
| Compound Name | 2,2-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 15389999 |
| Molecular Formula | C21H36F2O2 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2,2-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2CCC(C3COC(F)(F)OC3)CC2)CC1 |
| InChI | InChI=1S/C21H36F2O2/c1-2-3-4-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-24-21(22,23)25-15-20/h16-20H,2-15H2,1H3 |
| InChIKey | ZYBSLYJWJHHAAO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|