C17H31FO2 — CID 18344143
2-(2-fluoroethyl)-5-(4-pentylcyclohexyl)-1,3-dioxane (PubChem CID 18344143) has the molecular formula C17H31FO2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-5-(4-pentylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-(2-fluoroethyl)-5-(4-pentylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 18344143 |
| Molecular Formula | C17H31FO2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-(2-fluoroethyl)-5-(4-pentylcyclohexyl)-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2COC(CCF)OC2)CC1 |
| InChI | InChI=1S/C17H31FO2/c1-2-3-4-5-14-6-8-15(9-7-14)16-12-19-17(10-11-18)20-13-16/h14-17H,2-13H2,1H3 |
| InChIKey | PFWRQIXVKZPJAU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|