C10H13N2+ — CID 15397539
1-(cyclopenta-2,4-dien-1-ylmethyl)-3-methylimidazol-3-ium (PubChem CID 15397539) has the molecular formula C10H13N2+ and a molecular weight of 161.23 g/mol. Its IUPAC name is 1-(cyclopenta-2,4-dien-1-ylmethyl)-3-methylimidazol-3-ium.
| Compound Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 15397539 |
| Molecular Formula | C10H13N2+ |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)-3-methylimidazol-3-ium |
| SMILES | C[n+]1ccn(CC2C=CC=C2)c1 |
| InChI | InChI=1S/C10H13N2/c1-11-6-7-12(9-11)8-10-4-2-3-5-10/h2-7,9-10H,8H2,1H3/q+1 |
| InChIKey | JRKRVLIMVJQWCZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|