C8H9N3OS — CID 15398928
4-(2-isocyano-1,3-thiazol-5-yl)morpholine (PubChem CID 15398928) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 4-(2-isocyano-1,3-thiazol-5-yl)morpholine.
| Compound Name | 4-(2-isocyano-1,3-thiazol-5-yl)morpholine |
|---|---|
| PubChem CID | 15398928 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 4-(2-isocyano-1,3-thiazol-5-yl)morpholine |
| SMILES | [C-]#[N+]c1ncc(N2CCOCC2)s1 |
| InChI | InChI=1S/C8H9N3OS/c1-9-8-10-6-7(13-8)11-2-4-12-5-3-11/h6H,2-5H2 |
| InChIKey | UKVYQGDFXVJGOY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|