C11H11F3O5P- — CID 154001372
4-(dimethoxyphosphorylmethyl)-3-(trifluoromethyl)benzoate (PubChem CID 154001372) has the molecular formula C11H11F3O5P- and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-(dimethoxyphosphorylmethyl)-3-(trifluoromethyl)benzoate.
| Compound Name | 4-(dimethoxyphosphorylmethyl)-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 154001372 |
| Molecular Formula | C11H11F3O5P- |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-(dimethoxyphosphorylmethyl)-3-(trifluoromethyl)benzoate |
| SMILES | COP(=O)(Cc1ccc(C(=O)[O-])cc1C(F)(F)F)OC |
| InChI | InChI=1S/C11H12F3O5P/c1-18-20(17,19-2)6-8-4-3-7(10(15)16)5-9(8)11(12,13)14/h3-5H,6H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | IIENUUAEODKUPU-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|