C18H19F3N2O5S — CID 154003393
N-(4-propan-2-yloxyphenyl)-3-sulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-2H-pyridine-2-carboxamide (PubChem CID 154003393) has the molecular formula C18H19F3N2O5S and a molecular weight of 432.42 g/mol. Its IUPAC name is N-(4-propan-2-yloxyphenyl)-3-sulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-2H-pyridine-2-carboxamide.
| Compound Name | N-(4-propan-2-yloxyphenyl)-3-sulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-2H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154003393 |
| Molecular Formula | C18H19F3N2O5S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-(4-propan-2-yloxyphenyl)-3-sulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-2H-pyridine-2-carboxamide |
| SMILES | CC(C)Oc1ccc(N(CC(O)C(F)(F)F)C(=O)C2N=CC=CC2=S(=O)=O)cc1 |
| InChI | InChI=1S/C18H19F3N2O5S/c1-11(2)28-13-7-5-12(6-8-13)23(10-15(24)18(19,20)21)17(25)16-14(29(26)27)4-3-9-22-16/h3-9,11,15-16,24H,10H2,1-2H3 |
| InChIKey | UOKQDNCHQSGQPD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|